C9H3ClF3N — CID 165442306
3-chloro-6,7,8-trifluoroisoquinoline (PubChem CID 165442306) has the molecular formula C9H3ClF3N and a molecular weight of 217.58 g/mol. Its IUPAC name is 3-chloro-6,7,8-trifluoroisoquinoline.
| Compound Name | 3-chloro-6,7,8-trifluoroisoquinoline |
|---|---|
| PubChem CID | 165442306 |
| Molecular Formula | C9H3ClF3N |
| Molecular Weight | 217.58 g/mol |
| Exact Mass | 216.99 |
| IUPAC Name | 3-chloro-6,7,8-trifluoroisoquinoline |
| SMILES | Fc1cc2cc(Cl)ncc2c(F)c1F |
| InChI | InChI=1S/C9H3ClF3N/c10-7-2-4-1-6(11)9(13)8(12)5(4)3-14-7/h1-3H |
| InChIKey | IOVBTUCHDMXUKJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|