About 3-(fluoromethyl)undecane
3-(fluoromethyl)undecane (PubChem CID 11658419) has the molecular formula C12H25F
and a molecular weight of 188.33 g/mol. Its IUPAC name is 3-(fluoromethyl)undecane.
Molecular Properties
| Compound Name | 3-(fluoromethyl)undecane |
| PubChem CID | 11658419 |
| Molecular Formula | C12H25F |
| Molecular Weight | 188.33 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | 3-(fluoromethyl)undecane |
| SMILES | CCCCCCCCC(CC)CF |
| InChI | InChI=1S/C12H25F/c1-3-5-6-7-8-9-10-12(4-2)11-13/h12H,3-11H2,1-2H3 |
| InChIKey | UVEHWOQDJSTKTO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(fluoromethyl)undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(fluoromethyl)undecane?
The IUPAC name of 3-(fluoromethyl)undecane (CID 11658419) is 3-(fluoromethyl)undecane.
What is the SMILES notation for 3-(fluoromethyl)undecane?
The canonical SMILES for 3-(fluoromethyl)undecane is CCCCCCCCC(CC)CF.
What is the InChIKey of 3-(fluoromethyl)undecane?
The InChIKey is UVEHWOQDJSTKTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25F/c1-3-5-6-7-8-9-10-12(4-2)11-13/h12H,3-11H2,1-2H3.
What are the key properties of 3-(fluoromethyl)undecane?
3-(fluoromethyl)undecane has a molecular weight of 188.33 g/mol, XLogP of 4.73, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(fluoromethyl)undecane is sourced from PubChem (CID 11658419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).