About disodium;N-(2-amino-2-hydroxyethylidene)undecanamide;hydride
disodium;N-(2-amino-2-hydroxyethylidene)undecanamide;hydride (PubChem CID 173236386) has the molecular formula C13H28N2Na2O2
and a molecular weight of 290.36 g/mol. Its IUPAC name is disodium;N-(2-amino-2-hydroxyethylidene)undecanamide;hydride.
Molecular Properties
| Compound Name | disodium;N-(2-amino-2-hydroxyethylidene)undecanamide;hydride |
| PubChem CID | 173236386 |
| Molecular Formula | C13H28N2Na2O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | disodium;N-(2-amino-2-hydroxyethylidene)undecanamide;hydride |
| SMILES | CCCCCCCCCCC(=O)/N=C/C(N)O.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C13H26N2O2.2Na.2H/c1-2-3-4-5-6-7-8-9-10-13(17)15-11-12(14)16;;;;/h11-12,16H,2-10,14H2,1H3;;;;/q;2*+1;2*-1/b15-11+;;;; |
| InChIKey | KCAIWOHZWJBUIA-KJSXAQCBSA-N |
| XLogP | -3.38 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze disodium;N-(2-amino-2-hydroxyethylidene)undecanamide;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;N-(2-amino-2-hydroxyethylidene)undecanamide;hydride?
The IUPAC name of disodium;N-(2-amino-2-hydroxyethylidene)undecanamide;hydride (CID 173236386) is disodium;N-(2-amino-2-hydroxyethylidene)undecanamide;hydride.
What is the SMILES notation for disodium;N-(2-amino-2-hydroxyethylidene)undecanamide;hydride?
The canonical SMILES for disodium;N-(2-amino-2-hydroxyethylidene)undecanamide;hydride is CCCCCCCCCCC(=O)/N=C/C(N)O.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;N-(2-amino-2-hydroxyethylidene)undecanamide;hydride?
The InChIKey is KCAIWOHZWJBUIA-KJSXAQCBSA-N. The full InChI is InChI=1S/C13H26N2O2.2Na.2H/c1-2-3-4-5-6-7-8-9-10-13(17)15-11-12(14)16;;;;/h11-12,16H,2-10,14H2,1H3;;;;/q;2*+1;2*-1/b15-11+;;;;.
What are the key properties of disodium;N-(2-amino-2-hydroxyethylidene)undecanamide;hydride?
disodium;N-(2-amino-2-hydroxyethylidene)undecanamide;hydride has a molecular weight of 290.36 g/mol, XLogP of -3.38, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;N-(2-amino-2-hydroxyethylidene)undecanamide;hydride is sourced from PubChem (CID 173236386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).