C31H31Zr- — CID 173239679
di(propan-2-ylidene)zirconium;1-(3-methyl-5-phenylcyclopenta-1,3-dien-1-yl)-9H-fluoren-9-ide (PubChem CID 173239679) has the molecular formula C31H31Zr- and a molecular weight of 494.81 g/mol. Its IUPAC name is di(propan-2-ylidene)zirconium;1-(3-methyl-5-phenylcyclopenta-1,3-dien-1-yl)-9H-fluoren-9-ide.
| Compound Name | di(propan-2-ylidene)zirconium;1-(3-methyl-5-phenylcyclopenta-1,3-dien-1-yl)-9H-fluoren-9-ide |
|---|---|
| PubChem CID | 173239679 |
| Molecular Formula | C31H31Zr- |
| Molecular Weight | 494.81 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | di(propan-2-ylidene)zirconium;1-(3-methyl-5-phenylcyclopenta-1,3-dien-1-yl)-9H-fluoren-9-ide |
| SMILES | CC(C)=[Zr]=C(C)C.CC1=CC(c2ccccc2)C(c2cccc3c2[cH-]c2ccccc23)=C1 |
| InChI | InChI=1S/C25H19.2C3H6.Zr/c1-17-14-23(18-8-3-2-4-9-18)24(15-17)22-13-7-12-21-20-11-6-5-10-19(20)16-25(21)22;2*1-3-2;/h2-16,23H,1H3;2*1-2H3;/q-1;;; |
| InChIKey | WODBOWOCFOALMN-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.81 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|