C13H23NO2Si — CID 173240002
4-(3,3-diethoxy-3-silylpropyl)aniline (PubChem CID 173240002) has the molecular formula C13H23NO2Si and a molecular weight of 253.42 g/mol. Its IUPAC name is 4-(3,3-diethoxy-3-silylpropyl)aniline.
| Compound Name | 4-(3,3-diethoxy-3-silylpropyl)aniline |
|---|---|
| PubChem CID | 173240002 |
| Molecular Formula | C13H23NO2Si |
| Molecular Weight | 253.42 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 4-(3,3-diethoxy-3-silylpropyl)aniline |
| SMILES | CCOC([SiH3])(CCc1ccc(N)cc1)OCC |
| InChI | InChI=1S/C13H23NO2Si/c1-3-15-13(17,16-4-2)10-9-11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2,17H3 |
| InChIKey | JXMAFPALOOMORS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|