C8H13NO2 — CID 173240380
2,3-dimethoxycyclohexa-1,3-dien-1-amine (PubChem CID 173240380) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 2,3-dimethoxycyclohexa-1,3-dien-1-amine.
| Compound Name | 2,3-dimethoxycyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 173240380 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 2,3-dimethoxycyclohexa-1,3-dien-1-amine |
| SMILES | COC1=CCCC(N)=C1OC |
| InChI | InChI=1S/C8H13NO2/c1-10-7-5-3-4-6(9)8(7)11-2/h5H,3-4,9H2,1-2H3 |
| InChIKey | AZORYCPFYVONKK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |