C24H28N4S — CID 173241684
N-(1-adamantyl)-N-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]methanethioamide (PubChem CID 173241684) has the molecular formula C24H28N4S and a molecular weight of 404.58 g/mol. Its IUPAC name is N-(1-adamantyl)-N-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]methanethioamide.
| Compound Name | N-(1-adamantyl)-N-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]methanethioamide |
|---|---|
| PubChem CID | 173241684 |
| Molecular Formula | C24H28N4S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-(1-adamantyl)-N-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]ethyl]methanethioamide |
| SMILES | N#Cc1ccc(Cn2cncc2CCN(C=S)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C24H28N4S/c25-13-18-1-3-19(4-2-18)15-27-16-26-14-23(27)5-6-28(17-29)24-10-20-7-21(11-24)9-22(8-20)12-24/h1-4,14,16-17,20-22H,5-12,15H2 |
| InChIKey | BBFUVLKNRUSYAE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|