C13H12N4 — CID 90951320
4-[[5-[(methylideneamino)methyl]imidazol-1-yl]methyl]benzonitrile (PubChem CID 90951320) has the molecular formula C13H12N4 and a molecular weight of 224.27 g/mol. Its IUPAC name is 4-[[5-[(methylideneamino)methyl]imidazol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[5-[(methylideneamino)methyl]imidazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 90951320 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 4-[[5-[(methylideneamino)methyl]imidazol-1-yl]methyl]benzonitrile |
| SMILES | C=NCc1cncn1Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H12N4/c1-15-7-13-8-16-10-17(13)9-12-4-2-11(6-14)3-5-12/h2-5,8,10H,1,7,9H2 |
| InChIKey | DCJDWIHLYBGVPJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 53.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|