C24H17ClFN3 — CID 18779174
4-[[3-[[4-(2-chloro-4-fluorophenyl)phenyl]methyl]imidazol-4-yl]methyl]benzonitrile (PubChem CID 18779174) has the molecular formula C24H17ClFN3 and a molecular weight of 401.87 g/mol. Its IUPAC name is 4-[[3-[[4-(2-chloro-4-fluorophenyl)phenyl]methyl]imidazol-4-yl]methyl]benzonitrile.
| Compound Name | 4-[[3-[[4-(2-chloro-4-fluorophenyl)phenyl]methyl]imidazol-4-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 18779174 |
| Molecular Formula | C24H17ClFN3 |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 4-[[3-[[4-(2-chloro-4-fluorophenyl)phenyl]methyl]imidazol-4-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cc2cncn2Cc2ccc(-c3ccc(F)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C24H17ClFN3/c25-24-12-21(26)9-10-23(24)20-7-5-19(6-8-20)15-29-16-28-14-22(29)11-17-1-3-18(13-27)4-2-17/h1-10,12,14,16H,11,15H2 |
| InChIKey | YHGOUUFAKZOCHR-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |