C23H19ClN4 — CID 70342547
4-[[3-[(6-phenyl-3-pyridinyl)methyl]imidazol-4-yl]methyl]benzonitrile;hydrochloride (PubChem CID 70342547) has the molecular formula C23H19ClN4 and a molecular weight of 386.89 g/mol. Its IUPAC name is 4-[[3-[(6-phenyl-3-pyridinyl)methyl]imidazol-4-yl]methyl]benzonitrile;hydrochloride.
| Compound Name | 4-[[3-[(6-phenyl-3-pyridinyl)methyl]imidazol-4-yl]methyl]benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 70342547 |
| Molecular Formula | C23H19ClN4 |
| Molecular Weight | 386.89 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 4-[[3-[(6-phenyl-3-pyridinyl)methyl]imidazol-4-yl]methyl]benzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1ccc(Cc2cncn2Cc2ccc(-c3ccccc3)nc2)cc1 |
| InChI | InChI=1S/C23H18N4.ClH/c24-13-19-8-6-18(7-9-19)12-22-15-25-17-27(22)16-20-10-11-23(26-14-20)21-4-2-1-3-5-21;/h1-11,14-15,17H,12,16H2;1H |
| InChIKey | MQYOEVPAFSEWAY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.89 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |