About 4-[[3-[2-(3-phenyl-1,2-oxazol-5-yl)acetyl]imidazol-4-yl]methyl]benzonitrile
4-[[3-[2-(3-phenyl-1,2-oxazol-5-yl)acetyl]imidazol-4-yl]methyl]benzonitrile (PubChem CID 54500200) has the molecular formula C22H16N4O2
and a molecular weight of 368.40 g/mol. Its IUPAC name is 4-[[3-[2-(3-phenyl-1,2-oxazol-5-yl)acetyl]imidazol-4-yl]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[3-[2-(3-phenyl-1,2-oxazol-5-yl)acetyl]imidazol-4-yl]methyl]benzonitrile |
| PubChem CID | 54500200 |
| Molecular Formula | C22H16N4O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 4-[[3-[2-(3-phenyl-1,2-oxazol-5-yl)acetyl]imidazol-4-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cc2cncn2C(=O)Cc2cc(-c3ccccc3)no2)cc1 |
| InChI | InChI=1S/C22H16N4O2/c23-13-17-8-6-16(7-9-17)10-19-14-24-15-26(19)22(27)12-20-11-21(25-28-20)18-4-2-1-3-5-18/h1-9,11,14-15H,10,12H2 |
| InChIKey | YBWPBENQTIGYOG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 84.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[3-[2-(3-phenyl-1,2-oxazol-5-yl)acetyl]imidazol-4-yl]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-[2-(3-phenyl-1,2-oxazol-5-yl)acetyl]imidazol-4-yl]methyl]benzonitrile?
The IUPAC name of 4-[[3-[2-(3-phenyl-1,2-oxazol-5-yl)acetyl]imidazol-4-yl]methyl]benzonitrile (CID 54500200) is 4-[[3-[2-(3-phenyl-1,2-oxazol-5-yl)acetyl]imidazol-4-yl]methyl]benzonitrile.
What is the SMILES notation for 4-[[3-[2-(3-phenyl-1,2-oxazol-5-yl)acetyl]imidazol-4-yl]methyl]benzonitrile?
The canonical SMILES for 4-[[3-[2-(3-phenyl-1,2-oxazol-5-yl)acetyl]imidazol-4-yl]methyl]benzonitrile is N#Cc1ccc(Cc2cncn2C(=O)Cc2cc(-c3ccccc3)no2)cc1.
What is the InChIKey of 4-[[3-[2-(3-phenyl-1,2-oxazol-5-yl)acetyl]imidazol-4-yl]methyl]benzonitrile?
The InChIKey is YBWPBENQTIGYOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N4O2/c23-13-17-8-6-16(7-9-17)10-19-14-24-15-26(19)22(27)12-20-11-21(25-28-20)18-4-2-1-3-5-18/h1-9,11,14-15H,10,12H2.
What are the key properties of 4-[[3-[2-(3-phenyl-1,2-oxazol-5-yl)acetyl]imidazol-4-yl]methyl]benzonitrile?
4-[[3-[2-(3-phenyl-1,2-oxazol-5-yl)acetyl]imidazol-4-yl]methyl]benzonitrile has a molecular weight of 368.40 g/mol, XLogP of 3.88, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-[2-(3-phenyl-1,2-oxazol-5-yl)acetyl]imidazol-4-yl]methyl]benzonitrile is sourced from PubChem (CID 54500200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).