C24H27F9O4S2 — CID 173242879
10-butoxy-1,4-dimethyl-1,2,3,4-tetrahydroanthracene-9-thiol;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid (PubChem CID 173242879) has the molecular formula C24H27F9O4S2 and a molecular weight of 614.59 g/mol. Its IUPAC name is 10-butoxy-1,4-dimethyl-1,2,3,4-tetrahydroanthracene-9-thiol;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid.
| Compound Name | 10-butoxy-1,4-dimethyl-1,2,3,4-tetrahydroanthracene-9-thiol;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 173242879 |
| Molecular Formula | C24H27F9O4S2 |
| Molecular Weight | 614.59 g/mol |
| Exact Mass | 614.12 |
| IUPAC Name | 10-butoxy-1,4-dimethyl-1,2,3,4-tetrahydroanthracene-9-thiol;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
| SMILES | CCCCOc1c2c(c(S)c3ccccc13)C(C)CCC2C.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H26OS.C4HF9O3S/c1-4-5-12-21-19-15-8-6-7-9-16(15)20(22)18-14(3)11-10-13(2)17(18)19;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h6-9,13-14,22H,4-5,10-12H2,1-3H3;(H,14,15,16) |
| InChIKey | IIFHZRHLDIGMLE-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.59 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|