C12H22N2O4SSi — CID 173243053
[4-[4-(silylmethylamino)butoxy]phenyl]methylsulfamic acid (PubChem CID 173243053) has the molecular formula C12H22N2O4SSi and a molecular weight of 318.47 g/mol. Its IUPAC name is [4-[4-(silylmethylamino)butoxy]phenyl]methylsulfamic acid.
| Compound Name | [4-[4-(silylmethylamino)butoxy]phenyl]methylsulfamic acid |
|---|---|
| PubChem CID | 173243053 |
| Molecular Formula | C12H22N2O4SSi |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | [4-[4-(silylmethylamino)butoxy]phenyl]methylsulfamic acid |
| SMILES | O=S(=O)(O)NCc1ccc(OCCCCNC[SiH3])cc1 |
| InChI | InChI=1S/C12H22N2O4SSi/c15-19(16,17)14-9-11-3-5-12(6-4-11)18-8-2-1-7-13-10-20/h3-6,13-14H,1-2,7-10H2,20H3,(H,15,16,17) |
| InChIKey | PCBLLKLIFMTDNY-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|