C12H19NO4S — CID 3577672
[4-[(3-methoxypropylamino)methyl]phenyl] methanesulfonate (PubChem CID 3577672) has the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. Its IUPAC name is [4-[(3-methoxypropylamino)methyl]phenyl] methanesulfonate.
| Compound Name | [4-[(3-methoxypropylamino)methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 3577672 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | [4-[(3-methoxypropylamino)methyl]phenyl] methanesulfonate |
| SMILES | COCCCNCc1ccc(OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H19NO4S/c1-16-9-3-8-13-10-11-4-6-12(7-5-11)17-18(2,14)15/h4-7,13H,3,8-10H2,1-2H3 |
| InChIKey | HYCBVLHCHJKAMV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|