C23H32N4O6 — CID 19038480
1-hydroxy-3-[[4-[7-[4-[(hydroxycarbamoylamino)methyl]phenoxy]heptoxy]phenyl]methyl]urea (PubChem CID 19038480) has the molecular formula C23H32N4O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is 1-hydroxy-3-[[4-[7-[4-[(hydroxycarbamoylamino)methyl]phenoxy]heptoxy]phenyl]methyl]urea.
| Compound Name | 1-hydroxy-3-[[4-[7-[4-[(hydroxycarbamoylamino)methyl]phenoxy]heptoxy]phenyl]methyl]urea |
|---|---|
| PubChem CID | 19038480 |
| Molecular Formula | C23H32N4O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 1-hydroxy-3-[[4-[7-[4-[(hydroxycarbamoylamino)methyl]phenoxy]heptoxy]phenyl]methyl]urea |
| SMILES | O=C(NO)NCc1ccc(OCCCCCCCOc2ccc(CNC(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C23H32N4O6/c28-22(26-30)24-16-18-6-10-20(11-7-18)32-14-4-2-1-3-5-15-33-21-12-8-19(9-13-21)17-25-23(29)27-31/h6-13,30-31H,1-5,14-17H2,(H2,24,26,28)(H2,25,27,29) |
| InChIKey | MGSSICAVRWNPCP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 141.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|