C15H26O3 — CID 173243699
2-(5-hydroxy-3-methylpenta-1,3-dienyl)-3-(1-hydroxypropyl)-1-methylcyclopentan-1-ol (PubChem CID 173243699) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 2-(5-hydroxy-3-methylpenta-1,3-dienyl)-3-(1-hydroxypropyl)-1-methylcyclopentan-1-ol.
| Compound Name | 2-(5-hydroxy-3-methylpenta-1,3-dienyl)-3-(1-hydroxypropyl)-1-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 173243699 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 2-(5-hydroxy-3-methylpenta-1,3-dienyl)-3-(1-hydroxypropyl)-1-methylcyclopentan-1-ol |
| SMILES | CCC(O)C1CCC(C)(O)C1C=CC(C)=CCO |
| InChI | InChI=1S/C15H26O3/c1-4-14(17)12-7-9-15(3,18)13(12)6-5-11(2)8-10-16/h5-6,8,12-14,16-18H,4,7,9-10H2,1-3H3 |
| InChIKey | LYQIOUQVAUZAMM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|