C27H23ClN4O5S — CID 17324572
ethyl 4-[[3-benzamido-1-(4-chlorophenyl)-6-oxo-2-sulfanylidene-1,3-diazinane-4-carbonyl]amino]benzoate (PubChem CID 17324572) has the molecular formula C27H23ClN4O5S and a molecular weight of 551.02 g/mol. Its IUPAC name is ethyl 4-[[3-benzamido-1-(4-chlorophenyl)-6-oxo-2-sulfanylidene-1,3-diazinane-4-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[3-benzamido-1-(4-chlorophenyl)-6-oxo-2-sulfanylidene-1,3-diazinane-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 17324572 |
| Molecular Formula | C27H23ClN4O5S |
| Molecular Weight | 551.02 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | ethyl 4-[[3-benzamido-1-(4-chlorophenyl)-6-oxo-2-sulfanylidene-1,3-diazinane-4-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C2CC(=O)N(c3ccc(Cl)cc3)C(=S)N2NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H23ClN4O5S/c1-2-37-26(36)18-8-12-20(13-9-18)29-25(35)22-16-23(33)31(21-14-10-19(28)11-15-21)27(38)32(22)30-24(34)17-6-4-3-5-7-17/h3-15,22H,2,16H2,1H3,(H,29,35)(H,30,34) |
| InChIKey | IBINQAQPNHABFI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.02 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|