C29H36N4O4 — CID 17324628
3-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-4-(4-methoxybenzoyl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one (PubChem CID 17324628) has the molecular formula C29H36N4O4 and a molecular weight of 504.63 g/mol. Its IUPAC name is 3-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-4-(4-methoxybenzoyl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one.
| Compound Name | 3-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-4-(4-methoxybenzoyl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
|---|---|
| PubChem CID | 17324628 |
| Molecular Formula | C29H36N4O4 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 3-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-4-(4-methoxybenzoyl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
| SMILES | COc1ccc(C(=O)N2C(CC(=O)N3CCN(Cc4ccccc4)CC3)C(=O)NC3CCCCC32)cc1 |
| InChI | InChI=1S/C29H36N4O4/c1-37-23-13-11-22(12-14-23)29(36)33-25-10-6-5-9-24(25)30-28(35)26(33)19-27(34)32-17-15-31(16-18-32)20-21-7-3-2-4-8-21/h2-4,7-8,11-14,24-26H,5-6,9-10,15-20H2,1H3,(H,30,35) |
| InChIKey | CNSVAGWINDSHCL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |