C18H22OS — CID 173247446
1-[3,5-di(propan-2-yl)phenyl]-2-thiophen-3-ylethanone (PubChem CID 173247446) has the molecular formula C18H22OS and a molecular weight of 286.44 g/mol. Its IUPAC name is 1-[3,5-di(propan-2-yl)phenyl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[3,5-di(propan-2-yl)phenyl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 173247446 |
| Molecular Formula | C18H22OS |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-[3,5-di(propan-2-yl)phenyl]-2-thiophen-3-ylethanone |
| SMILES | CC(C)c1cc(C(=O)Cc2ccsc2)cc(C(C)C)c1 |
| InChI | InChI=1S/C18H22OS/c1-12(2)15-8-16(13(3)4)10-17(9-15)18(19)7-14-5-6-20-11-14/h5-6,8-13H,7H2,1-4H3 |
| InChIKey | MQTXWVUGBMHHOG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |