C11H18N4O7 — CID 173248629
2-[4-(2-hydroxyethoxy)-3,5-dimethoxyphenyl]guanidine;nitric acid (PubChem CID 173248629) has the molecular formula C11H18N4O7 and a molecular weight of 318.29 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethoxy)-3,5-dimethoxyphenyl]guanidine;nitric acid.
| Compound Name | 2-[4-(2-hydroxyethoxy)-3,5-dimethoxyphenyl]guanidine;nitric acid |
|---|---|
| PubChem CID | 173248629 |
| Molecular Formula | C11H18N4O7 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-[4-(2-hydroxyethoxy)-3,5-dimethoxyphenyl]guanidine;nitric acid |
| SMILES | COc1cc(N=C(N)N)cc(OC)c1OCCO.O=[N+]([O-])O |
| InChI | InChI=1S/C11H17N3O4.HNO3/c1-16-8-5-7(14-11(12)13)6-9(17-2)10(8)18-4-3-15;2-1(3)4/h5-6,15H,3-4H2,1-2H3,(H4,12,13,14);(H,2,3,4) |
| InChIKey | MQUXLIPLZMKYOJ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 175.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|