C12H20O — CID 173250219
(3E,6E)-2-methylundeca-3,6-dienal (PubChem CID 173250219) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (3E,6E)-2-methylundeca-3,6-dienal.
| Compound Name | (3E,6E)-2-methylundeca-3,6-dienal |
|---|---|
| PubChem CID | 173250219 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (3E,6E)-2-methylundeca-3,6-dienal |
| SMILES | CCCC/C=C/C/C=C/C(C)C=O |
| InChI | InChI=1S/C12H20O/c1-3-4-5-6-7-8-9-10-12(2)11-13/h6-7,9-12H,3-5,8H2,1-2H3/b7-6+,10-9+ |
| InChIKey | RKHXLGLRENZWQN-AVQMFFATSA-N |
| XLogP | 3.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|