C29H39N3O6 — CID 173251029
benzyl N-[(2S)-1-[[(2S)-7-[(4-hydroxy-3-methyl-1-oxobutan-2-yl)amino]-7-oxo-1-phenylheptan-2-yl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 173251029) has the molecular formula C29H39N3O6 and a molecular weight of 525.65 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2S)-7-[(4-hydroxy-3-methyl-1-oxobutan-2-yl)amino]-7-oxo-1-phenylheptan-2-yl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(2S)-7-[(4-hydroxy-3-methyl-1-oxobutan-2-yl)amino]-7-oxo-1-phenylheptan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 173251029 |
| Molecular Formula | C29H39N3O6 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S)-7-[(4-hydroxy-3-methyl-1-oxobutan-2-yl)amino]-7-oxo-1-phenylheptan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(CO)C(C=O)NC(=O)CCCC[C@@H](Cc1ccccc1)NC(=O)[C@H](C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H39N3O6/c1-21(18-33)26(19-34)32-27(35)16-10-9-15-25(17-23-11-5-3-6-12-23)31-28(36)22(2)30-29(37)38-20-24-13-7-4-8-14-24/h3-8,11-14,19,21-22,25-26,33H,9-10,15-18,20H2,1-2H3,(H,30,37)(H,31,36)(H,32,35)/t21?,22-,25-,26?/m0/s1 |
| InChIKey | FBPNLQSEFGSNTF-WWLAAKCUSA-N |
| XLogP | 2.90 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|