C21H33N — CID 173251824
2-(2-ethyl-2,7-dimethylnonyl)-1H-indole (PubChem CID 173251824) has the molecular formula C21H33N and a molecular weight of 299.50 g/mol. Its IUPAC name is 2-(2-ethyl-2,7-dimethylnonyl)-1H-indole.
| Compound Name | 2-(2-ethyl-2,7-dimethylnonyl)-1H-indole |
|---|---|
| PubChem CID | 173251824 |
| Molecular Formula | C21H33N |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | 2-(2-ethyl-2,7-dimethylnonyl)-1H-indole |
| SMILES | CCC(C)CCCCC(C)(CC)Cc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H33N/c1-5-17(3)11-9-10-14-21(4,6-2)16-19-15-18-12-7-8-13-20(18)22-19/h7-8,12-13,15,17,22H,5-6,9-11,14,16H2,1-4H3 |
| InChIKey | LYBIBBWTLYDODI-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|