C21H26N2O4 — CID 173251982
N-(3-amino-3-oxopropyl)-N-(methoxymethyl)-3-(4-phenylmethoxyphenyl)propanamide (PubChem CID 173251982) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-N-(methoxymethyl)-3-(4-phenylmethoxyphenyl)propanamide.
| Compound Name | N-(3-amino-3-oxopropyl)-N-(methoxymethyl)-3-(4-phenylmethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 173251982 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-N-(methoxymethyl)-3-(4-phenylmethoxyphenyl)propanamide |
| SMILES | COCN(CCC(N)=O)C(=O)CCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H26N2O4/c1-26-16-23(14-13-20(22)24)21(25)12-9-17-7-10-19(11-8-17)27-15-18-5-3-2-4-6-18/h2-8,10-11H,9,12-16H2,1H3,(H2,22,24) |
| InChIKey | MJSXJWGPIYOMRV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|