C15H29N5O3 — CID 173253387
2-[1-[5-(diaminomethylideneamino)pentanoyl]piperidin-3-yl]oxy-2-methylpropanamide (PubChem CID 173253387) has the molecular formula C15H29N5O3 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-[1-[5-(diaminomethylideneamino)pentanoyl]piperidin-3-yl]oxy-2-methylpropanamide.
| Compound Name | 2-[1-[5-(diaminomethylideneamino)pentanoyl]piperidin-3-yl]oxy-2-methylpropanamide |
|---|---|
| PubChem CID | 173253387 |
| Molecular Formula | C15H29N5O3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 2-[1-[5-(diaminomethylideneamino)pentanoyl]piperidin-3-yl]oxy-2-methylpropanamide |
| SMILES | CC(C)(OC1CCCN(C(=O)CCCCN=C(N)N)C1)C(N)=O |
| InChI | InChI=1S/C15H29N5O3/c1-15(2,13(16)22)23-11-6-5-9-20(10-11)12(21)7-3-4-8-19-14(17)18/h11H,3-10H2,1-2H3,(H2,16,22)(H4,17,18,19) |
| InChIKey | SVCDOQJBIWOHFN-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|