C14H30N5OP — CID 90824466
2-[6-[4-[dimethyl(methylidene)-λ5-phosphanyl]piperazin-1-yl]-6-oxohexyl]guanidine (PubChem CID 90824466) has the molecular formula C14H30N5OP and a molecular weight of 315.40 g/mol. Its IUPAC name is 2-[6-[4-[dimethyl(methylidene)-λ5-phosphanyl]piperazin-1-yl]-6-oxohexyl]guanidine.
| Compound Name | 2-[6-[4-[dimethyl(methylidene)-λ5-phosphanyl]piperazin-1-yl]-6-oxohexyl]guanidine |
|---|---|
| PubChem CID | 90824466 |
| Molecular Formula | C14H30N5OP |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 2-[6-[4-[dimethyl(methylidene)-λ5-phosphanyl]piperazin-1-yl]-6-oxohexyl]guanidine |
| SMILES | C=P(C)(C)N1CCN(C(=O)CCCCCN=C(N)N)CC1 |
| InChI | InChI=1S/C14H30N5OP/c1-21(2,3)19-11-9-18(10-12-19)13(20)7-5-4-6-8-17-14(15)16/h1,4-12H2,2-3H3,(H4,15,16,17) |
| InChIKey | UFDUPPMWZMUYBQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|