About N-methoxy-1-azabicyclo[2.2.1]heptane-3-carboximidoyl cyanide;oxalic acid
N-methoxy-1-azabicyclo[2.2.1]heptane-3-carboximidoyl cyanide;oxalic acid (PubChem CID 173253753) has the molecular formula C11H15N3O5
and a molecular weight of 269.26 g/mol. Its IUPAC name is N-methoxy-1-azabicyclo[2.2.1]heptane-3-carboximidoyl cyanide;oxalic acid.
Molecular Properties
| Compound Name | N-methoxy-1-azabicyclo[2.2.1]heptane-3-carboximidoyl cyanide;oxalic acid |
| PubChem CID | 173253753 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | N-methoxy-1-azabicyclo[2.2.1]heptane-3-carboximidoyl cyanide;oxalic acid |
| SMILES | CON=C(C#N)C1CN2CCC1C2.O=C(O)C(=O)O |
| InChI | InChI=1S/C9H13N3O.C2H2O4/c1-13-11-9(4-10)8-6-12-3-2-7(8)5-12;3-1(4)2(5)6/h7-8H,2-3,5-6H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | PKYIWAIVDMXTOZ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-1-azabicyclo[2.2.1]heptane-3-carboximidoyl cyanide;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-1-azabicyclo[2.2.1]heptane-3-carboximidoyl cyanide;oxalic acid?
The IUPAC name of N-methoxy-1-azabicyclo[2.2.1]heptane-3-carboximidoyl cyanide;oxalic acid (CID 173253753) is N-methoxy-1-azabicyclo[2.2.1]heptane-3-carboximidoyl cyanide;oxalic acid.
What is the SMILES notation for N-methoxy-1-azabicyclo[2.2.1]heptane-3-carboximidoyl cyanide;oxalic acid?
The canonical SMILES for N-methoxy-1-azabicyclo[2.2.1]heptane-3-carboximidoyl cyanide;oxalic acid is CON=C(C#N)C1CN2CCC1C2.O=C(O)C(=O)O.
What is the InChIKey of N-methoxy-1-azabicyclo[2.2.1]heptane-3-carboximidoyl cyanide;oxalic acid?
The InChIKey is PKYIWAIVDMXTOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O.C2H2O4/c1-13-11-9(4-10)8-6-12-3-2-7(8)5-12;3-1(4)2(5)6/h7-8H,2-3,5-6H2,1H3;(H,3,4)(H,5,6).
What are the key properties of N-methoxy-1-azabicyclo[2.2.1]heptane-3-carboximidoyl cyanide;oxalic acid?
N-methoxy-1-azabicyclo[2.2.1]heptane-3-carboximidoyl cyanide;oxalic acid has a molecular weight of 269.26 g/mol, XLogP of -0.38, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-1-azabicyclo[2.2.1]heptane-3-carboximidoyl cyanide;oxalic acid is sourced from PubChem (CID 173253753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).