C24H32O — CID 173253910
1-[1-(3-benzyl-2-tert-butylphenyl)ethyl]cyclopentan-1-ol (PubChem CID 173253910) has the molecular formula C24H32O and a molecular weight of 336.52 g/mol. Its IUPAC name is 1-[1-(3-benzyl-2-tert-butylphenyl)ethyl]cyclopentan-1-ol.
| Compound Name | 1-[1-(3-benzyl-2-tert-butylphenyl)ethyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 173253910 |
| Molecular Formula | C24H32O |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 1-[1-(3-benzyl-2-tert-butylphenyl)ethyl]cyclopentan-1-ol |
| SMILES | CC(c1cccc(Cc2ccccc2)c1C(C)(C)C)C1(O)CCCC1 |
| InChI | InChI=1S/C24H32O/c1-18(24(25)15-8-9-16-24)21-14-10-13-20(22(21)23(2,3)4)17-19-11-6-5-7-12-19/h5-7,10-14,18,25H,8-9,15-17H2,1-4H3 |
| InChIKey | XKYRJEXGSILNQB-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |