C13H19NO — CID 19702313
1-(1-amino-2-phenylethyl)cyclopentan-1-ol (PubChem CID 19702313) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(1-amino-2-phenylethyl)cyclopentan-1-ol.
| Compound Name | 1-(1-amino-2-phenylethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 19702313 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-(1-amino-2-phenylethyl)cyclopentan-1-ol |
| SMILES | NC(Cc1ccccc1)C1(O)CCCC1 |
| InChI | InChI=1S/C13H19NO/c14-12(13(15)8-4-5-9-13)10-11-6-2-1-3-7-11/h1-3,6-7,12,15H,4-5,8-10,14H2 |
| InChIKey | WIXQOWFUZDGWLU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |