C24H28N2O4 — CID 173254193
N-[4-methyl-1-oxo-1-[[(3Z,6S)-7-oxo-5,6-dihydro-2H-oxocin-6-yl]amino]pentan-2-yl]naphthalene-2-carboxamide (PubChem CID 173254193) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-[4-methyl-1-oxo-1-[[(3Z,6S)-7-oxo-5,6-dihydro-2H-oxocin-6-yl]amino]pentan-2-yl]naphthalene-2-carboxamide.
| Compound Name | N-[4-methyl-1-oxo-1-[[(3Z,6S)-7-oxo-5,6-dihydro-2H-oxocin-6-yl]amino]pentan-2-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 173254193 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-[4-methyl-1-oxo-1-[[(3Z,6S)-7-oxo-5,6-dihydro-2H-oxocin-6-yl]amino]pentan-2-yl]naphthalene-2-carboxamide |
| SMILES | CC(C)CC(NC(=O)c1ccc2ccccc2c1)C(=O)N[C@H]1C/C=C\COCC1=O |
| InChI | InChI=1S/C24H28N2O4/c1-16(2)13-21(24(29)25-20-9-5-6-12-30-15-22(20)27)26-23(28)19-11-10-17-7-3-4-8-18(17)14-19/h3-8,10-11,14,16,20-21H,9,12-13,15H2,1-2H3,(H,25,29)(H,26,28)/b6-5-/t20-,21?/m0/s1 |
| InChIKey | FOMUUNFCJDZYTK-KETLOJFTSA-N |
| XLogP | 3.01 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|