C26H39N3O4 — CID 90702063
N-[4-methyl-1-oxo-1-[[(4S)-3-oxo-5-propyloxan-4-yl]amino]pentan-2-yl]-3-piperidin-1-ylbenzamide (PubChem CID 90702063) has the molecular formula C26H39N3O4 and a molecular weight of 457.62 g/mol. Its IUPAC name is N-[4-methyl-1-oxo-1-[[(4S)-3-oxo-5-propyloxan-4-yl]amino]pentan-2-yl]-3-piperidin-1-ylbenzamide.
| Compound Name | N-[4-methyl-1-oxo-1-[[(4S)-3-oxo-5-propyloxan-4-yl]amino]pentan-2-yl]-3-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 90702063 |
| Molecular Formula | C26H39N3O4 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | N-[4-methyl-1-oxo-1-[[(4S)-3-oxo-5-propyloxan-4-yl]amino]pentan-2-yl]-3-piperidin-1-ylbenzamide |
| SMILES | CCCC1COCC(=O)[C@H]1NC(=O)C(CC(C)C)NC(=O)c1cccc(N2CCCCC2)c1 |
| InChI | InChI=1S/C26H39N3O4/c1-4-9-20-16-33-17-23(30)24(20)28-26(32)22(14-18(2)3)27-25(31)19-10-8-11-21(15-19)29-12-6-5-7-13-29/h8,10-11,15,18,20,22,24H,4-7,9,12-14,16-17H2,1-3H3,(H,27,31)(H,28,32)/t20?,22?,24-/m0/s1 |
| InChIKey | CBYNNHKVCJSYNH-JVPYDEADSA-N |
| XLogP | 3.32 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |