C18H25N3O4 — CID 90757931
2-amino-N-[4-methyl-1-[[(2R,3S)-2-methyl-4-oxooxolan-3-yl]amino]-1-oxopentan-2-yl]benzamide (PubChem CID 90757931) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-amino-N-[4-methyl-1-[[(2R,3S)-2-methyl-4-oxooxolan-3-yl]amino]-1-oxopentan-2-yl]benzamide.
| Compound Name | 2-amino-N-[4-methyl-1-[[(2R,3S)-2-methyl-4-oxooxolan-3-yl]amino]-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 90757931 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-amino-N-[4-methyl-1-[[(2R,3S)-2-methyl-4-oxooxolan-3-yl]amino]-1-oxopentan-2-yl]benzamide |
| SMILES | CC(C)CC(NC(=O)c1ccccc1N)C(=O)N[C@@H]1C(=O)CO[C@@H]1C |
| InChI | InChI=1S/C18H25N3O4/c1-10(2)8-14(18(24)21-16-11(3)25-9-15(16)22)20-17(23)12-6-4-5-7-13(12)19/h4-7,10-11,14,16H,8-9,19H2,1-3H3,(H,20,23)(H,21,24)/t11-,14?,16+/m1/s1 |
| InChIKey | PTBGTJLEYVYFIS-DMPVCAQSSA-N |
| XLogP | 0.89 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|