C22H30N2O4 — CID 91112482
4-tert-butyl-N-[4-methyl-1-[[(2R,3S)-2-methyl-4-oxooxolan-3-yl]amino]-1-oxopent-4-en-2-yl]benzamide (PubChem CID 91112482) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-methyl-1-[[(2R,3S)-2-methyl-4-oxooxolan-3-yl]amino]-1-oxopent-4-en-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-methyl-1-[[(2R,3S)-2-methyl-4-oxooxolan-3-yl]amino]-1-oxopent-4-en-2-yl]benzamide |
|---|---|
| PubChem CID | 91112482 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 4-tert-butyl-N-[4-methyl-1-[[(2R,3S)-2-methyl-4-oxooxolan-3-yl]amino]-1-oxopent-4-en-2-yl]benzamide |
| SMILES | C=C(C)CC(NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)N[C@@H]1C(=O)CO[C@@H]1C |
| InChI | InChI=1S/C22H30N2O4/c1-13(2)11-17(21(27)24-19-14(3)28-12-18(19)25)23-20(26)15-7-9-16(10-8-15)22(4,5)6/h7-10,14,17,19H,1,11-12H2,2-6H3,(H,23,26)(H,24,27)/t14-,17?,19+/m1/s1 |
| InChIKey | DZNKZQYRZVLBBR-UKFYSOHNSA-N |
| XLogP | 2.52 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|