C16H22N2O5 — CID 67075324
N-[(2S)-1-[[(3R)-2-methyl-4-oxooxolan-3-yl]amino]-1-oxohexan-2-yl]furan-3-carboxamide (PubChem CID 67075324) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is N-[(2S)-1-[[(3R)-2-methyl-4-oxooxolan-3-yl]amino]-1-oxohexan-2-yl]furan-3-carboxamide.
| Compound Name | N-[(2S)-1-[[(3R)-2-methyl-4-oxooxolan-3-yl]amino]-1-oxohexan-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 67075324 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-[(2S)-1-[[(3R)-2-methyl-4-oxooxolan-3-yl]amino]-1-oxohexan-2-yl]furan-3-carboxamide |
| SMILES | CCCC[C@H](NC(=O)c1ccoc1)C(=O)N[C@H]1C(=O)COC1C |
| InChI | InChI=1S/C16H22N2O5/c1-3-4-5-12(17-15(20)11-6-7-22-8-11)16(21)18-14-10(2)23-9-13(14)19/h6-8,10,12,14H,3-5,9H2,1-2H3,(H,17,20)(H,18,21)/t10?,12-,14+/m0/s1 |
| InChIKey | GHUWRJXARIMTIP-BNPZDMCGSA-N |
| XLogP | 1.04 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |