C20H28N2O4 — CID 22935937
N-[1-[(2-ethyl-4-oxooxolan-3-yl)amino]-5-methyl-1-oxohexan-2-yl]benzamide (PubChem CID 22935937) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is N-[1-[(2-ethyl-4-oxooxolan-3-yl)amino]-5-methyl-1-oxohexan-2-yl]benzamide.
| Compound Name | N-[1-[(2-ethyl-4-oxooxolan-3-yl)amino]-5-methyl-1-oxohexan-2-yl]benzamide |
|---|---|
| PubChem CID | 22935937 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-[1-[(2-ethyl-4-oxooxolan-3-yl)amino]-5-methyl-1-oxohexan-2-yl]benzamide |
| SMILES | CCC1OCC(=O)C1NC(=O)C(CCC(C)C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H28N2O4/c1-4-17-18(16(23)12-26-17)22-20(25)15(11-10-13(2)3)21-19(24)14-8-6-5-7-9-14/h5-9,13,15,17-18H,4,10-12H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | KLCFEASEDMLHGH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |