C16H27NO3 — CID 173255507
2,2-dimethylpropyl 2-[(2S)-1-cyclohexyl-1-oxopropan-2-yl]iminoacetate (PubChem CID 173255507) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-[(2S)-1-cyclohexyl-1-oxopropan-2-yl]iminoacetate.
| Compound Name | 2,2-dimethylpropyl 2-[(2S)-1-cyclohexyl-1-oxopropan-2-yl]iminoacetate |
|---|---|
| PubChem CID | 173255507 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 2,2-dimethylpropyl 2-[(2S)-1-cyclohexyl-1-oxopropan-2-yl]iminoacetate |
| SMILES | C[C@H](/N=C/C(=O)OCC(C)(C)C)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C16H27NO3/c1-12(15(19)13-8-6-5-7-9-13)17-10-14(18)20-11-16(2,3)4/h10,12-13H,5-9,11H2,1-4H3/b17-10+/t12-/m0/s1 |
| InChIKey | RGMQODVKSBPXQI-VAKHEIKFSA-N |
| XLogP | 3.18 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|