C23H42O4 — CID 118088525
bis(2,2-dimethylpropyl) 2-cyclopentyl-2-(3-methylbutyl)propanedioate (PubChem CID 118088525) has the molecular formula C23H42O4 and a molecular weight of 382.59 g/mol. Its IUPAC name is bis(2,2-dimethylpropyl) 2-cyclopentyl-2-(3-methylbutyl)propanedioate.
| Compound Name | bis(2,2-dimethylpropyl) 2-cyclopentyl-2-(3-methylbutyl)propanedioate |
|---|---|
| PubChem CID | 118088525 |
| Molecular Formula | C23H42O4 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | bis(2,2-dimethylpropyl) 2-cyclopentyl-2-(3-methylbutyl)propanedioate |
| SMILES | CC(C)CCC(C(=O)OCC(C)(C)C)(C(=O)OCC(C)(C)C)C1CCCC1 |
| InChI | InChI=1S/C23H42O4/c1-17(2)13-14-23(18-11-9-10-12-18,19(24)26-15-21(3,4)5)20(25)27-16-22(6,7)8/h17-18H,9-16H2,1-8H3 |
| InChIKey | XAMAKWGIZTZXSB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|