C22H40O4 — CID 118088481
bis(2,2-dimethylpropyl) 2-cyclopentyl-2-(2-methylpropyl)propanedioate (PubChem CID 118088481) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is bis(2,2-dimethylpropyl) 2-cyclopentyl-2-(2-methylpropyl)propanedioate.
| Compound Name | bis(2,2-dimethylpropyl) 2-cyclopentyl-2-(2-methylpropyl)propanedioate |
|---|---|
| PubChem CID | 118088481 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | bis(2,2-dimethylpropyl) 2-cyclopentyl-2-(2-methylpropyl)propanedioate |
| SMILES | CC(C)CC(C(=O)OCC(C)(C)C)(C(=O)OCC(C)(C)C)C1CCCC1 |
| InChI | InChI=1S/C22H40O4/c1-16(2)13-22(17-11-9-10-12-17,18(23)25-14-20(3,4)5)19(24)26-15-21(6,7)8/h16-17H,9-15H2,1-8H3 |
| InChIKey | FADGXYQFIIKJHQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|