C17H18S2 — CID 173258078
1-ethylsulfanyl-1,3-diphenylpropane-2-thione (PubChem CID 173258078) has the molecular formula C17H18S2 and a molecular weight of 286.47 g/mol. Its IUPAC name is 1-ethylsulfanyl-1,3-diphenylpropane-2-thione.
| Compound Name | 1-ethylsulfanyl-1,3-diphenylpropane-2-thione |
|---|---|
| PubChem CID | 173258078 |
| Molecular Formula | C17H18S2 |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1-ethylsulfanyl-1,3-diphenylpropane-2-thione |
| SMILES | CCSC(C(=S)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18S2/c1-2-19-17(15-11-7-4-8-12-15)16(18)13-14-9-5-3-6-10-14/h3-12,17H,2,13H2,1H3 |
| InChIKey | YNXUGEREAHTRCI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|