C16H28F5NO — CID 173258409
N-decyl-5,5,6,6,6-pentafluorohexanamide (PubChem CID 173258409) has the molecular formula C16H28F5NO and a molecular weight of 345.40 g/mol. Its IUPAC name is N-decyl-5,5,6,6,6-pentafluorohexanamide.
| Compound Name | N-decyl-5,5,6,6,6-pentafluorohexanamide |
|---|---|
| PubChem CID | 173258409 |
| Molecular Formula | C16H28F5NO |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-decyl-5,5,6,6,6-pentafluorohexanamide |
| SMILES | CCCCCCCCCCNC(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H28F5NO/c1-2-3-4-5-6-7-8-9-13-22-14(23)11-10-12-15(17,18)16(19,20)21/h2-13H2,1H3,(H,22,23) |
| InChIKey | XEMZOONDVPEWPL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|