C15H27F5O2S — CID 173258436
10-(4,4,5,5,5-pentafluoropentylsulfinyl)decan-4-ol (PubChem CID 173258436) has the molecular formula C15H27F5O2S and a molecular weight of 366.44 g/mol. Its IUPAC name is 10-(4,4,5,5,5-pentafluoropentylsulfinyl)decan-4-ol.
| Compound Name | 10-(4,4,5,5,5-pentafluoropentylsulfinyl)decan-4-ol |
|---|---|
| PubChem CID | 173258436 |
| Molecular Formula | C15H27F5O2S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 10-(4,4,5,5,5-pentafluoropentylsulfinyl)decan-4-ol |
| SMILES | CCCC(O)CCCCCCS(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H27F5O2S/c1-2-8-13(21)9-5-3-4-6-11-23(22)12-7-10-14(16,17)15(18,19)20/h13,21H,2-12H2,1H3 |
| InChIKey | KXEACTAEMRLDTL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|