C10H16AsNO — CID 173263316
2-arsanyl-N-propylcyclohexa-1,3-diene-1-carboxamide (PubChem CID 173263316) has the molecular formula C10H16AsNO and a molecular weight of 241.17 g/mol. Its IUPAC name is 2-arsanyl-N-propylcyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 2-arsanyl-N-propylcyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 173263316 |
| Molecular Formula | C10H16AsNO |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 2-arsanyl-N-propylcyclohexa-1,3-diene-1-carboxamide |
| SMILES | CCCNC(=O)C1=C([AsH2])C=CCC1 |
| InChI | InChI=1S/C10H16AsNO/c1-2-7-12-10(13)8-5-3-4-6-9(8)11/h4,6H,2-3,5,7,11H2,1H3,(H,12,13) |
| InChIKey | XZJLJSMFNGJECM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|