C39H42 — CID 173264827
2-phenylethylbenzene;1-(1-phenylethyl)-1,2,3,4-tetrahydronaphthalene;toluene (PubChem CID 173264827) has the molecular formula C39H42 and a molecular weight of 510.77 g/mol. Its IUPAC name is 2-phenylethylbenzene;1-(1-phenylethyl)-1,2,3,4-tetrahydronaphthalene;toluene.
| Compound Name | 2-phenylethylbenzene;1-(1-phenylethyl)-1,2,3,4-tetrahydronaphthalene;toluene |
|---|---|
| PubChem CID | 173264827 |
| Molecular Formula | C39H42 |
| Molecular Weight | 510.77 g/mol |
| Exact Mass | 510.33 |
| IUPAC Name | 2-phenylethylbenzene;1-(1-phenylethyl)-1,2,3,4-tetrahydronaphthalene;toluene |
| SMILES | CC(c1ccccc1)C1CCCc2ccccc21.Cc1ccccc1.c1ccc(CCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H20.C14H14.C7H8/c1-14(15-8-3-2-4-9-15)17-13-7-11-16-10-5-6-12-18(16)17;1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-7-5-3-2-4-6-7/h2-6,8-10,12,14,17H,7,11,13H2,1H3;1-10H,11-12H2;2-6H,1H3 |
| InChIKey | LEJOIPWUKHUGDI-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.77 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |