C18H34Cl2N2Si — CID 173270802
1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline;3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl(dichloro)silane (PubChem CID 173270802) has the molecular formula C18H34Cl2N2Si and a molecular weight of 377.48 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline;3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl(dichloro)silane.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline;3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl(dichloro)silane |
|---|---|
| PubChem CID | 173270802 |
| Molecular Formula | C18H34Cl2N2Si |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline;3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl(dichloro)silane |
| SMILES | C1CCC2NCCCC2C1.Cl[SiH](Cl)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C9H17Cl2NSi.C9H17N/c10-13(11)12-7-3-5-8-4-1-2-6-9(8)12;1-2-6-9-8(4-1)5-3-7-10-9/h8-9,13H,1-7H2;8-10H,1-7H2 |
| InChIKey | ZOZHIHQWTCLVCY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|