C16H34Si — CID 173272990
cycloheptyl(2,2,4,4-tetramethylpentan-3-yl)silane (PubChem CID 173272990) has the molecular formula C16H34Si and a molecular weight of 254.53 g/mol. Its IUPAC name is cycloheptyl(2,2,4,4-tetramethylpentan-3-yl)silane.
| Compound Name | cycloheptyl(2,2,4,4-tetramethylpentan-3-yl)silane |
|---|---|
| PubChem CID | 173272990 |
| Molecular Formula | C16H34Si |
| Molecular Weight | 254.53 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | cycloheptyl(2,2,4,4-tetramethylpentan-3-yl)silane |
| SMILES | CC(C)(C)C([SiH2]C1CCCCCC1)C(C)(C)C |
| InChI | InChI=1S/C16H34Si/c1-15(2,3)14(16(4,5)6)17-13-11-9-7-8-10-12-13/h13-14H,7-12,17H2,1-6H3 |
| InChIKey | ALAVMMXPUCBFBM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|