C11H23NO4 — CID 173278803
(Z)-3-amino-8-methyldec-7-ene-1,2,4,5-tetrol (PubChem CID 173278803) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is (Z)-3-amino-8-methyldec-7-ene-1,2,4,5-tetrol.
| Compound Name | (Z)-3-amino-8-methyldec-7-ene-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 173278803 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | (Z)-3-amino-8-methyldec-7-ene-1,2,4,5-tetrol |
| SMILES | CC/C(C)=C\CC(O)C(O)C(N)C(O)CO |
| InChI | InChI=1S/C11H23NO4/c1-3-7(2)4-5-8(14)11(16)10(12)9(15)6-13/h4,8-11,13-16H,3,5-6,12H2,1-2H3/b7-4- |
| InChIKey | FMTWKAURRAIERK-DAXSKMNVSA-N |
| XLogP | -0.86 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|