C35H58N2O6 — CID 173281361
1-adamantyl 2-aminoheptanoate;[1-(1-adamantyloxy)-1-oxoheptan-2-yl]carbamic acid (PubChem CID 173281361) has the molecular formula C35H58N2O6 and a molecular weight of 602.86 g/mol. Its IUPAC name is 1-adamantyl 2-aminoheptanoate;[1-(1-adamantyloxy)-1-oxoheptan-2-yl]carbamic acid.
| Compound Name | 1-adamantyl 2-aminoheptanoate;[1-(1-adamantyloxy)-1-oxoheptan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 173281361 |
| Molecular Formula | C35H58N2O6 |
| Molecular Weight | 602.86 g/mol |
| Exact Mass | 602.43 |
| IUPAC Name | 1-adamantyl 2-aminoheptanoate;[1-(1-adamantyloxy)-1-oxoheptan-2-yl]carbamic acid |
| SMILES | CCCCCC(N)C(=O)OC12CC3CC(CC(C3)C1)C2.CCCCCC(NC(=O)O)C(=O)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H29NO4.C17H29NO2/c1-2-3-4-5-15(19-17(21)22)16(20)23-18-9-12-6-13(10-18)8-14(7-12)11-18;1-2-3-4-5-15(18)16(19)20-17-9-12-6-13(10-17)8-14(7-12)11-17/h12-15,19H,2-11H2,1H3,(H,21,22);12-15H,2-11,18H2,1H3 |
| InChIKey | UYRYJTNMYVEAEA-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.86 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|