C31H37N3O7 — CID 173281799
tert-butyl 2-[4-[[2-butyl-5-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethylidene]-2-methyl-4-oxoimidazolidin-1-yl]methyl]phenyl]benzoate (PubChem CID 173281799) has the molecular formula C31H37N3O7 and a molecular weight of 563.65 g/mol. Its IUPAC name is tert-butyl 2-[4-[[2-butyl-5-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethylidene]-2-methyl-4-oxoimidazolidin-1-yl]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[[2-butyl-5-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethylidene]-2-methyl-4-oxoimidazolidin-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 173281799 |
| Molecular Formula | C31H37N3O7 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | tert-butyl 2-[4-[[2-butyl-5-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethylidene]-2-methyl-4-oxoimidazolidin-1-yl]methyl]phenyl]benzoate |
| SMILES | CCCCC1(C)NC(=O)C(=C(O)ON2C(=O)CCC2=O)N1Cc1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C31H37N3O7/c1-6-7-18-31(5)32-27(37)26(29(39)41-34-24(35)16-17-25(34)36)33(31)19-20-12-14-21(15-13-20)22-10-8-9-11-23(22)28(38)40-30(2,3)4/h8-15,39H,6-7,16-19H2,1-5H3,(H,32,37) |
| InChIKey | MXHIZYYFDUBENU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|