C24H28Zr — CID 173282418
2-ethylcyclopenta-1,3-diene;1-phenylethylidenezirconium(2+);4,5,6,7-tetrahydro-1H-inden-1-ide (PubChem CID 173282418) has the molecular formula C24H28Zr and a molecular weight of 407.71 g/mol. Its IUPAC name is 2-ethylcyclopenta-1,3-diene;1-phenylethylidenezirconium(2+);4,5,6,7-tetrahydro-1H-inden-1-ide.
| Compound Name | 2-ethylcyclopenta-1,3-diene;1-phenylethylidenezirconium(2+);4,5,6,7-tetrahydro-1H-inden-1-ide |
|---|---|
| PubChem CID | 173282418 |
| Molecular Formula | C24H28Zr |
| Molecular Weight | 407.71 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2-ethylcyclopenta-1,3-diene;1-phenylethylidenezirconium(2+);4,5,6,7-tetrahydro-1H-inden-1-ide |
| SMILES | CC(=[Zr+2])c1ccccc1.CCC1=CC[C-]=C1.c1cc2c([cH-]1)CCCC2 |
| InChI | InChI=1S/C9H11.C8H8.C7H9.Zr/c1-2-5-9-7-3-6-8(9)4-1;1-2-8-6-4-3-5-7-8;1-2-7-5-3-4-6-7;/h3,6-7H,1-2,4-5H2;3-7H,1H3;5-6H,2-3H2,1H3;/q-1;;-1;+2 |
| InChIKey | LNDORFBIMDIVDR-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.71 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|