C9H11Hf+3 — CID 18172278
hafnium(4+);4,5,6,7-tetrahydro-1H-inden-1-ide (PubChem CID 18172278) has the molecular formula C9H11Hf+3 and a molecular weight of 297.68 g/mol. Its IUPAC name is hafnium(4+);4,5,6,7-tetrahydro-1H-inden-1-ide.
| Compound Name | hafnium(4+);4,5,6,7-tetrahydro-1H-inden-1-ide |
|---|---|
| PubChem CID | 18172278 |
| Molecular Formula | C9H11Hf+3 |
| Molecular Weight | 297.68 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | hafnium(4+);4,5,6,7-tetrahydro-1H-inden-1-ide |
| SMILES | [Hf+4].c1cc2c([cH-]1)CCCC2 |
| InChI | InChI=1S/C9H11.Hf/c1-2-5-9-7-3-6-8(9)4-1;/h3,6-7H,1-2,4-5H2;/q-1;+4 |
| InChIKey | WEWFTBFEROVZIN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.68 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|